About Dicyclohexylborane 2-picoline
Dicyclohexylborane 2-picoline (PubChem CID 86634995) has the molecular formula C18H29BN
and a molecular weight of 270.25 g/mol.
Molecular Properties
| Compound Name | Dicyclohexylborane 2-picoline |
| PubChem CID | 86634995 |
| Molecular Formula | C18H29BN |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | — |
| SMILES | Cc1ccccn1.[B](C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C12H22B.C6H7N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-6-4-2-3-5-7-6/h11-12H,1-10H2;2-5H,1H3 |
| InChIKey | PORWBMJOQISXPX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Dicyclohexylborane 2-picoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dicyclohexylborane 2-picoline?
The IUPAC name of Dicyclohexylborane 2-picoline (CID 86634995) is not available.
What is the SMILES notation for Dicyclohexylborane 2-picoline?
The canonical SMILES for Dicyclohexylborane 2-picoline is Cc1ccccn1.[B](C1CCCCC1)C1CCCCC1.
What is the InChIKey of Dicyclohexylborane 2-picoline?
The InChIKey is PORWBMJOQISXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22B.C6H7N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-6-4-2-3-5-7-6/h11-12H,1-10H2;2-5H,1H3.
What are the key properties of Dicyclohexylborane 2-picoline?
Dicyclohexylborane 2-picoline has a molecular weight of 270.25 g/mol, XLogP of 5.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Dicyclohexylborane 2-picoline is sourced from PubChem (CID 86634995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).