C8H12N4O3S — CID 86635202
ethyl 2-(hydrazinecarbonylamino)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 86635202) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is ethyl 2-(hydrazinecarbonylamino)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(hydrazinecarbonylamino)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 86635202 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | ethyl 2-(hydrazinecarbonylamino)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)NN)nc1C |
| InChI | InChI=1S/C8H12N4O3S/c1-3-15-6(13)5-4(2)10-8(16-5)11-7(14)12-9/h3,9H2,1-2H3,(H2,10,11,12,14) |
| InChIKey | VULUZIDIGIKRKT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|