About tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate
tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate (PubChem CID 86635417) has the molecular formula C25H28Cl2N4O4
and a molecular weight of 519.43 g/mol. Its IUPAC name is tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate |
| PubChem CID | 86635417 |
| Molecular Formula | C25H28Cl2N4O4 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3ccc(Cl)c(Cl)c3)c2cc1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H28Cl2N4O4/c1-25(2,3)35-24(33)29-9-5-6-14-10-16-20(12-21(14)34-4)30-13-17(23(28)32)22(16)31-15-7-8-18(26)19(27)11-15/h7-8,10-13H,5-6,9H2,1-4H3,(H2,28,32)(H,29,33)(H,30,31) |
| InChIKey | FRDLNUUVCSLGIM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate?
The IUPAC name of tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate (CID 86635417) is tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate.
What is the SMILES notation for tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate?
The canonical SMILES for tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate is COc1cc2ncc(C(N)=O)c(Nc3ccc(Cl)c(Cl)c3)c2cc1CCCNC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate?
The InChIKey is FRDLNUUVCSLGIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28Cl2N4O4/c1-25(2,3)35-24(33)29-9-5-6-14-10-16-20(12-21(14)34-4)30-13-17(23(28)32)22(16)31-15-7-8-18(26)19(27)11-15/h7-8,10-13H,5-6,9H2,1-4H3,(H2,28,32)(H,29,33)(H,30,31).
What are the key properties of tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate?
tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate has a molecular weight of 519.43 g/mol, XLogP of 5.85, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-[3-carbamoyl-4-(3,4-dichloroanilino)-7-methoxyquinolin-6-yl]propyl]carbamate is sourced from PubChem (CID 86635417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).