C14H19F3N2OS — CID 86635616
(1R)-N-tert-butylsulfanyl-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]prop-2-en-1-amine (PubChem CID 86635616) has the molecular formula C14H19F3N2OS and a molecular weight of 320.38 g/mol. Its IUPAC name is (1R)-N-tert-butylsulfanyl-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]prop-2-en-1-amine.
| Compound Name | (1R)-N-tert-butylsulfanyl-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 86635616 |
| Molecular Formula | C14H19F3N2OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (1R)-N-tert-butylsulfanyl-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]prop-2-en-1-amine |
| SMILES | C=C[C@@H](NSC(C)(C)C)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C14H19F3N2OS/c1-5-11(19-21-13(2,3)4)12-7-6-10(8-18-12)20-9-14(15,16)17/h5-8,11,19H,1,9H2,2-4H3/t11-/m1/s1 |
| InChIKey | YGZYGYIDKPXNPE-LLVKDONJSA-N |
| XLogP | 4.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|