C32H30F7NO4 — CID 86636010
(1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-(4-fluorophenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 86636010) has the molecular formula C32H30F7NO4 and a molecular weight of 625.58 g/mol. Its IUPAC name is (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-(4-fluorophenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-(4-fluorophenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 86636010 |
| Molecular Formula | C32H30F7NO4 |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | (1S,2R,8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1-(4-fluorophenyl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C=C(C3=CCC4(CC3)OCCO4)C[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H30F7NO4/c1-18(21-12-23(31(34,35)36)16-24(13-21)32(37,38)39)44-27-17-40-26(29(27)20-2-4-25(33)5-3-20)14-22(15-28(40)41)19-6-8-30(9-7-19)42-10-11-43-30/h2-6,12-13,15-16,18,26-27,29H,7-11,14,17H2,1H3/t18-,26+,27+,29+/m1/s1 |
| InChIKey | ZZVBQLAUOHRWIW-XHAZDJPGSA-N |
| XLogP | 7.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |