About 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile
3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile (PubChem CID 86636059) has the molecular formula C11H9N5OS
and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile |
| PubChem CID | 86636059 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile |
| SMILES | N#Cc1cccc(-n2c(N)c(N)c(=O)[nH]c2=S)c1 |
| InChI | InChI=1S/C11H9N5OS/c12-5-6-2-1-3-7(4-6)16-9(14)8(13)10(17)15-11(16)18/h1-4H,13-14H2,(H,15,17,18) |
| InChIKey | BLGWZGQJYKELJH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile?
The IUPAC name of 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile (CID 86636059) is 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile.
What is the SMILES notation for 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile?
The canonical SMILES for 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile is N#Cc1cccc(-n2c(N)c(N)c(=O)[nH]c2=S)c1.
What is the InChIKey of 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile?
The InChIKey is BLGWZGQJYKELJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5OS/c12-5-6-2-1-3-7(4-6)16-9(14)8(13)10(17)15-11(16)18/h1-4H,13-14H2,(H,15,17,18).
What are the key properties of 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile?
3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile has a molecular weight of 259.29 g/mol, XLogP of 0.93, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile is sourced from PubChem (CID 86636059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).