C11H9N5OS — CID 86636059
3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile (PubChem CID 86636059) has the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile.
| Compound Name | 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 86636059 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-(5,6-diamino-4-oxo-2-sulfanylidenepyrimidin-1-yl)benzonitrile |
| SMILES | N#Cc1cccc(-n2c(N)c(N)c(=O)[nH]c2=S)c1 |
| InChI | InChI=1S/C11H9N5OS/c12-5-6-2-1-3-7(4-6)16-9(14)8(13)10(17)15-11(16)18/h1-4H,13-14H2,(H,15,17,18) |
| InChIKey | BLGWZGQJYKELJH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|