C24H25FN2O4S — CID 86636091
ethyl (E)-3-[7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]prop-2-enoate (PubChem CID 86636091) has the molecular formula C24H25FN2O4S and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl (E)-3-[7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86636091 |
| Molecular Formula | C24H25FN2O4S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | ethyl (E)-3-[7-[(4-fluorophenyl)sulfonyl-methylamino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c2n(c3ccccc13)CC(N(C)S(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C24H25FN2O4S/c1-3-31-24(28)15-13-21-20-6-4-5-7-22(20)27-16-18(10-14-23(21)27)26(2)32(29,30)19-11-8-17(25)9-12-19/h4-9,11-13,15,18H,3,10,14,16H2,1-2H3/b15-13+ |
| InChIKey | AASPTJSYFPKFRO-FYWRMAATSA-N |
| XLogP | 3.99 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|