About 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate
1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate (PubChem CID 86636558) has the molecular formula C7H15F2NO2
and a molecular weight of 183.20 g/mol. Its IUPAC name is 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate.
Molecular Properties
| Compound Name | 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate |
| PubChem CID | 86636558 |
| Molecular Formula | C7H15F2NO2 |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate |
| SMILES | C[N+](C)([O-])CC1CC(F)(F)C1.O |
| InChI | InChI=1S/C7H13F2NO.H2O/c1-10(2,11)5-6-3-7(8,9)4-6;/h6H,3-5H2,1-2H3;1H2 |
| InChIKey | PPCITCICHACWKH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 54.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate?
The IUPAC name of 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate (CID 86636558) is 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate.
What is the SMILES notation for 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate?
The canonical SMILES for 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate is C[N+](C)([O-])CC1CC(F)(F)C1.O.
What is the InChIKey of 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate?
The InChIKey is PPCITCICHACWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO.H2O/c1-10(2,11)5-6-3-7(8,9)4-6;/h6H,3-5H2,1-2H3;1H2.
What are the key properties of 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate?
1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate has a molecular weight of 183.20 g/mol, XLogP of 0.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluorocyclobutyl)-N,N-dimethylmethanamine oxide;hydrate is sourced from PubChem (CID 86636558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).