C10H14ClN5 — CID 86636617
N'-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)butane-1,4-diamine (PubChem CID 86636617) has the molecular formula C10H14ClN5 and a molecular weight of 239.71 g/mol. Its IUPAC name is N'-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)butane-1,4-diamine.
| Compound Name | N'-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 86636617 |
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N'-(2-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)butane-1,4-diamine |
| SMILES | NCCCCNc1nc(Cl)nc2[nH]ccc12 |
| InChI | InChI=1S/C10H14ClN5/c11-10-15-8(13-5-2-1-4-12)7-3-6-14-9(7)16-10/h3,6H,1-2,4-5,12H2,(H2,13,14,15,16) |
| InChIKey | ISBWMJFVHPZWGX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|