C21H18F4N4O4S — CID 86636718
N-[4-[4-[(3-cyano-4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonylphenyl]-2,2,2-trifluoroacetamide (PubChem CID 86636718) has the molecular formula C21H18F4N4O4S and a molecular weight of 498.46 g/mol. Its IUPAC name is N-[4-[4-[(3-cyano-4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonylphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[4-[(3-cyano-4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonylphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86636718 |
| Molecular Formula | C21H18F4N4O4S |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[4-[4-[(3-cyano-4-fluorophenyl)methoxyimino]piperidin-1-yl]sulfonylphenyl]-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1cc(CON=C2CCN(S(=O)(=O)c3ccc(NC(=O)C(F)(F)F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C21H18F4N4O4S/c22-19-6-1-14(11-15(19)12-26)13-33-28-17-7-9-29(10-8-17)34(31,32)18-4-2-16(3-5-18)27-20(30)21(23,24)25/h1-6,11H,7-10,13H2,(H,27,30) |
| InChIKey | UBIWSGLDOJKDIE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|