C15H16ClF3N2O2 — CID 86636724
2-chloro-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]ethanone (PubChem CID 86636724) has the molecular formula C15H16ClF3N2O2 and a molecular weight of 348.75 g/mol. Its IUPAC name is 2-chloro-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 86636724 |
| Molecular Formula | C15H16ClF3N2O2 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-chloro-1-[4-[[3-(trifluoromethyl)phenyl]methoxyimino]piperidin-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCC(=NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H16ClF3N2O2/c16-9-14(22)21-6-4-13(5-7-21)20-23-10-11-2-1-3-12(8-11)15(17,18)19/h1-3,8H,4-7,9-10H2 |
| InChIKey | AIBOAWSQASVNCK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|