C10H18Cl2O — CID 86637159
(2S,3S,5R)-1,3-dichloro-5-methylnon-8-en-2-ol (PubChem CID 86637159) has the molecular formula C10H18Cl2O and a molecular weight of 225.16 g/mol. Its IUPAC name is (2S,3S,5R)-1,3-dichloro-5-methylnon-8-en-2-ol.
| Compound Name | (2S,3S,5R)-1,3-dichloro-5-methylnon-8-en-2-ol |
|---|---|
| PubChem CID | 86637159 |
| Molecular Formula | C10H18Cl2O |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (2S,3S,5R)-1,3-dichloro-5-methylnon-8-en-2-ol |
| SMILES | C=CCC[C@@H](C)C[C@H](Cl)[C@@H](O)CCl |
| InChI | InChI=1S/C10H18Cl2O/c1-3-4-5-8(2)6-9(12)10(13)7-11/h3,8-10,13H,1,4-7H2,2H3/t8-,9+,10+/m1/s1 |
| InChIKey | SWPQCDQQDKVOIN-UTLUCORTSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|