About 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline
4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline (PubChem CID 86637396) has the molecular formula C12H8BrCl2F2N3
and a molecular weight of 383.02 g/mol. Its IUPAC name is 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline |
| PubChem CID | 86637396 |
| Molecular Formula | C12H8BrCl2F2N3 |
| Molecular Weight | 383.02 g/mol |
| Exact Mass | 380.92 |
| IUPAC Name | 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline |
| SMILES | Fc1cc(NCCc2c(Cl)ncnc2Cl)c(F)cc1Br |
| InChI | InChI=1S/C12H8BrCl2F2N3/c13-7-3-9(17)10(4-8(7)16)18-2-1-6-11(14)19-5-20-12(6)15/h3-5,18H,1-2H2 |
| InChIKey | YURNUFXFWQQRIN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline?
The IUPAC name of 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline (CID 86637396) is 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline.
What is the SMILES notation for 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline?
The canonical SMILES for 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline is Fc1cc(NCCc2c(Cl)ncnc2Cl)c(F)cc1Br.
What is the InChIKey of 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline?
The InChIKey is YURNUFXFWQQRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrCl2F2N3/c13-7-3-9(17)10(4-8(7)16)18-2-1-6-11(14)19-5-20-12(6)15/h3-5,18H,1-2H2.
What are the key properties of 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline?
4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline has a molecular weight of 383.02 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[2-(4,6-dichloropyrimidin-5-yl)ethyl]-2,5-difluoroaniline is sourced from PubChem (CID 86637396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).