C58H78O8S3 — CID 86637461
1,9,18-tris(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraene-2,17-diol (PubChem CID 86637461) has the molecular formula C58H78O8S3 and a molecular weight of 999.45 g/mol. Its IUPAC name is 1,9,18-tris(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraene-2,17-diol.
| Compound Name | 1,9,18-tris(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraene-2,17-diol |
|---|---|
| PubChem CID | 86637461 |
| Molecular Formula | C58H78O8S3 |
| Molecular Weight | 999.45 g/mol |
| Exact Mass | 998.49 |
| IUPAC Name | 1,9,18-tris(benzenesulfonyl)-3,7,12,16-tetramethyl-1,18-bis(2,6,6-trimethylcyclohexen-1-yl)octadeca-3,7,11,15-tetraene-2,17-diol |
| SMILES | CC(=CCC(C=C(C)CCC=C(C)C(O)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)CCC=C(C)C(O)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C58H78O8S3/c1-41(24-20-26-45(5)53(59)55(51-43(3)28-22-38-57(51,7)8)68(63,64)48-32-16-12-17-33-48)36-37-50(67(61,62)47-30-14-11-15-31-47)40-42(2)25-21-27-46(6)54(60)56(52-44(4)29-23-39-58(52,9)10)69(65,66)49-34-18-13-19-35-49/h11-19,26-27,30-36,40,50,53-56,59-60H,20-25,28-29,37-39H2,1-10H3 |
| InChIKey | MDSDYOAFPMSQNO-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.45 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|