C21H24F3NO5S — CID 86637942
[6,7-dimethoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydro-2H-isoquinolin-1-yl]methanesulfonic acid (PubChem CID 86637942) has the molecular formula C21H24F3NO5S and a molecular weight of 459.49 g/mol. Its IUPAC name is [6,7-dimethoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydro-2H-isoquinolin-1-yl]methanesulfonic acid.
| Compound Name | [6,7-dimethoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydro-2H-isoquinolin-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 86637942 |
| Molecular Formula | C21H24F3NO5S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [6,7-dimethoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydro-2H-isoquinolin-1-yl]methanesulfonic acid |
| SMILES | COc1cc2c(cc1OC)C(CCc1ccc(C(F)(F)F)cc1)(CS(=O)(=O)O)NCC2 |
| InChI | InChI=1S/C21H24F3NO5S/c1-29-18-11-15-8-10-25-20(13-31(26,27)28,17(15)12-19(18)30-2)9-7-14-3-5-16(6-4-14)21(22,23)24/h3-6,11-12,25H,7-10,13H2,1-2H3,(H,26,27,28) |
| InChIKey | SHZPOGMTQBKCCD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|