About N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide
N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide (PubChem CID 86638086) has the molecular formula C11H13N5S
and a molecular weight of 247.33 g/mol. Its IUPAC name is N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide.
Molecular Properties
| Compound Name | N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide |
| PubChem CID | 86638086 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide |
| SMILES | [H]/N=c1\cc(C)cc(C)n1NC(=S)n1ccnc1 |
| InChI | InChI=1S/C11H13N5S/c1-8-5-9(2)16(10(12)6-8)14-11(17)15-4-3-13-7-15/h3-7,12H,1-2H3,(H,14,17)/b12-10+ |
| InChIKey | UGJIUAZSDLOQPK-ZRDIBKRKSA-N |
| XLogP | 1.16 |
| TPSA | 58.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide?
The IUPAC name of N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide (CID 86638086) is N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide.
What is the SMILES notation for N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide?
The canonical SMILES for N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide is [H]/N=c1\cc(C)cc(C)n1NC(=S)n1ccnc1.
What is the InChIKey of N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide?
The InChIKey is UGJIUAZSDLOQPK-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H13N5S/c1-8-5-9(2)16(10(12)6-8)14-11(17)15-4-3-13-7-15/h3-7,12H,1-2H3,(H,14,17)/b12-10+.
What are the key properties of N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide?
N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide has a molecular weight of 247.33 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-imino-4,6-dimethyl-1-pyridinyl)imidazole-1-carbothioamide is sourced from PubChem (CID 86638086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).