C42H37F6N3O2 — CID 86638505
4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-1,1,1-trifluoro-3,3-dimethylbutan-2-ol (PubChem CID 86638505) has the molecular formula C42H37F6N3O2 and a molecular weight of 729.77 g/mol. Its IUPAC name is 4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-1,1,1-trifluoro-3,3-dimethylbutan-2-ol.
| Compound Name | 4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-1,1,1-trifluoro-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 86638505 |
| Molecular Formula | C42H37F6N3O2 |
| Molecular Weight | 729.77 g/mol |
| Exact Mass | 729.28 |
| IUPAC Name | 4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-1,1,1-trifluoro-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c(CC(O)(c2ccc(-c3ccc(F)cn3)cc2)C(F)F)n1)C(O)C(F)(F)F |
| InChI | InChI=1S/C42H37F6N3O2/c1-39(2,37(52)42(46,47)48)24-34-27-51(41(30-12-6-3-7-13-30,31-14-8-4-9-15-31)32-16-10-5-11-17-32)36(50-34)25-40(53,38(44)45)29-20-18-28(19-21-29)35-23-22-33(43)26-49-35/h3-23,26-27,37-38,52-53H,24-25H2,1-2H3 |
| InChIKey | LIOGXINQWIFHDN-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.77 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|