C16H12ClFN2O2S — CID 86638718
5-chloro-2-[4-(1,3-dioxan-2-yl)-2-fluorophenyl]-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 86638718) has the molecular formula C16H12ClFN2O2S and a molecular weight of 350.80 g/mol. Its IUPAC name is 5-chloro-2-[4-(1,3-dioxan-2-yl)-2-fluorophenyl]-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[4-(1,3-dioxan-2-yl)-2-fluorophenyl]-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 86638718 |
| Molecular Formula | C16H12ClFN2O2S |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-chloro-2-[4-(1,3-dioxan-2-yl)-2-fluorophenyl]-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Fc1cc(C2OCCCO2)ccc1-c1nc2nc(Cl)ccc2s1 |
| InChI | InChI=1S/C16H12ClFN2O2S/c17-13-5-4-12-14(19-13)20-15(23-12)10-3-2-9(8-11(10)18)16-21-6-1-7-22-16/h2-5,8,16H,1,6-7H2 |
| InChIKey | ILAIPOOQUOIKFG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|