About 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium
1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium (PubChem CID 86638824) has the molecular formula C25H26F2O5S2
and a molecular weight of 508.61 g/mol. Its IUPAC name is 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium |
| PubChem CID | 86638824 |
| Molecular Formula | C25H26F2O5S2 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium |
| SMILES | CCCCC(=O)OCC(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C7H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-6(10)14-5-7(8,9)15(11,12)13/h1-15H;2-5H2,1H3,(H,11,12,13)/q+1;/p-1 |
| InChIKey | XGVNENXDSWFMHI-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium?
The IUPAC name of 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium (CID 86638824) is 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium.
What is the SMILES notation for 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium?
The canonical SMILES for 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium is CCCCC(=O)OCC(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium?
The InChIKey is XGVNENXDSWFMHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C7H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-6(10)14-5-7(8,9)15(11,12)13/h1-15H;2-5H2,1H3,(H,11,12,13)/q+1;/p-1.
What are the key properties of 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium?
1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium has a molecular weight of 508.61 g/mol, XLogP of 5.64, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-pentanoyloxyethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 86638824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).