C15H12Cl2N4O — CID 86638885
2-(azidomethyl)-8-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 86638885) has the molecular formula C15H12Cl2N4O and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-(azidomethyl)-8-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2-(azidomethyl)-8-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 86638885 |
| Molecular Formula | C15H12Cl2N4O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-(azidomethyl)-8-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | [N-]=[N+]=NCC1CNc2cccc(-c3ccc(Cl)cc3Cl)c2O1 |
| InChI | InChI=1S/C15H12Cl2N4O/c16-9-4-5-11(13(17)6-9)12-2-1-3-14-15(12)22-10(7-19-14)8-20-21-18/h1-6,10,19H,7-8H2 |
| InChIKey | RNPPVAWAISYKRU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|