C20H25F3N4O7 — CID 86639018
N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 86639018) has the molecular formula C20H25F3N4O7 and a molecular weight of 490.44 g/mol. Its IUPAC name is N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 86639018 |
| Molecular Formula | C20H25F3N4O7 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | O=C(CCCCCNC(=O)C(F)(F)F)NCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C20H25F3N4O7/c21-20(22,23)19(31)25-7-3-1-2-6-16(30)24-8-4-5-13-9-17(27(32)33)26(11-13)18-10-14(29)15(12-28)34-18/h9,11,14-15,18,28-29H,1-3,6-8,10,12H2,(H,24,30)(H,25,31)/t14-,15+,18+/m0/s1 |
| InChIKey | QNKGBFQIDCUSJV-HDMKZQKVSA-N |
| XLogP | 0.74 |
| TPSA | 155.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|