C22H27F3N4O8 — CID 86639019
[(2R,3S,5R)-2-(hydroxymethyl)-5-[2-nitro-4-[3-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]prop-1-ynyl]pyrrol-1-yl]oxolan-3-yl] acetate (PubChem CID 86639019) has the molecular formula C22H27F3N4O8 and a molecular weight of 532.47 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-nitro-4-[3-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]prop-1-ynyl]pyrrol-1-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-nitro-4-[3-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]prop-1-ynyl]pyrrol-1-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 86639019 |
| Molecular Formula | C22H27F3N4O8 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-nitro-4-[3-[6-[(2,2,2-trifluoroacetyl)amino]hexanoylamino]prop-1-ynyl]pyrrol-1-yl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](n2cc(C#CCNC(=O)CCCCCNC(=O)C(F)(F)F)cc2[N+](=O)[O-])O[C@@H]1CO |
| InChI | InChI=1S/C22H27F3N4O8/c1-14(31)36-16-11-20(37-17(16)13-30)28-12-15(10-19(28)29(34)35)6-5-9-26-18(32)7-3-2-4-8-27-21(33)22(23,24)25/h10,12,16-17,20,30H,2-4,7-9,11,13H2,1H3,(H,26,32)(H,27,33)/t16-,17+,20+/m0/s1 |
| InChIKey | ABNAYTYEPMPSGE-SQGPQFPESA-N |
| XLogP | 1.31 |
| TPSA | 162.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|