C27H21N5O3S — CID 86639156
methyl 2-[(9S)-7-[4-(3-cyanophenyl)phenyl]-4-formyl-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 86639156) has the molecular formula C27H21N5O3S and a molecular weight of 495.56 g/mol. Its IUPAC name is methyl 2-[(9S)-7-[4-(3-cyanophenyl)phenyl]-4-formyl-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | methyl 2-[(9S)-7-[4-(3-cyanophenyl)phenyl]-4-formyl-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 86639156 |
| Molecular Formula | C27H21N5O3S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | methyl 2-[(9S)-7-[4-(3-cyanophenyl)phenyl]-4-formyl-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1N=C(c2ccc(-c3cccc(C#N)c3)cc2)c2c(sc(C=O)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C27H21N5O3S/c1-15-22(14-33)36-27-24(15)25(29-21(12-23(34)35-3)26-31-30-16(2)32(26)27)19-9-7-18(8-10-19)20-6-4-5-17(11-20)13-28/h4-11,14,21H,12H2,1-3H3/t21-/m0/s1 |
| InChIKey | STWCYGGNJXRYSL-NRFANRHFSA-N |
| XLogP | 4.75 |
| TPSA | 110.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|