C16H26F3N3O3 — CID 86639175
(2S)-N-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetate (PubChem CID 86639175) has the molecular formula C16H26F3N3O3 and a molecular weight of 365.40 g/mol. Its IUPAC name is (2S)-N-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | (2S)-N-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 86639175 |
| Molecular Formula | C16H26F3N3O3 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2S)-N-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetate |
| SMILES | O=C(NCC[N+]12CCC(CC1)CC2)[C@@H]1CCCN1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H25N3O.C2HF3O2/c18-14(13-2-1-6-15-13)16-7-11-17-8-3-12(4-9-17)5-10-17;3-2(4,5)1(6)7/h12-13,15H,1-11H2;(H,6,7)/t12?,13-,17?;/m0./s1 |
| InChIKey | DKDFEKGKUFLQCI-JIOLICJLSA-N |
| XLogP | -0.22 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|