About butan-2-one;ethane-1,2-diol
butan-2-one;ethane-1,2-diol (PubChem CID 86639476) has the molecular formula C6H14O3
and a molecular weight of 134.17 g/mol. Its IUPAC name is butan-2-one;ethane-1,2-diol.
Molecular Properties
| Compound Name | butan-2-one;ethane-1,2-diol |
| PubChem CID | 86639476 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | butan-2-one;ethane-1,2-diol |
| SMILES | CCC(C)=O.OCCO |
| InChI | InChI=1S/C4H8O.C2H6O2/c1-3-4(2)5;3-1-2-4/h3H2,1-2H3;3-4H,1-2H2 |
| InChIKey | PTORNGPDBUCLLR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-2-one;ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;ethane-1,2-diol?
The IUPAC name of butan-2-one;ethane-1,2-diol (CID 86639476) is butan-2-one;ethane-1,2-diol.
What is the SMILES notation for butan-2-one;ethane-1,2-diol?
The canonical SMILES for butan-2-one;ethane-1,2-diol is CCC(C)=O.OCCO.
What is the InChIKey of butan-2-one;ethane-1,2-diol?
The InChIKey is PTORNGPDBUCLLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C2H6O2/c1-3-4(2)5;3-1-2-4/h3H2,1-2H3;3-4H,1-2H2.
What are the key properties of butan-2-one;ethane-1,2-diol?
butan-2-one;ethane-1,2-diol has a molecular weight of 134.17 g/mol, XLogP of -0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;ethane-1,2-diol is sourced from PubChem (CID 86639476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).