About pentan-3-one;propane-1,2,3-triol
pentan-3-one;propane-1,2,3-triol (PubChem CID 86639489) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is pentan-3-one;propane-1,2,3-triol.
Molecular Properties
| Compound Name | pentan-3-one;propane-1,2,3-triol |
| PubChem CID | 86639489 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | pentan-3-one;propane-1,2,3-triol |
| SMILES | CCC(=O)CC.OCC(O)CO |
| InChI | InChI=1S/C5H10O.C3H8O3/c1-3-5(6)4-2;4-1-3(6)2-5/h3-4H2,1-2H3;3-6H,1-2H2 |
| InChIKey | KHSIHACLUWINOG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentan-3-one;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-one;propane-1,2,3-triol?
The IUPAC name of pentan-3-one;propane-1,2,3-triol (CID 86639489) is pentan-3-one;propane-1,2,3-triol.
What is the SMILES notation for pentan-3-one;propane-1,2,3-triol?
The canonical SMILES for pentan-3-one;propane-1,2,3-triol is CCC(=O)CC.OCC(O)CO.
What is the InChIKey of pentan-3-one;propane-1,2,3-triol?
The InChIKey is KHSIHACLUWINOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C3H8O3/c1-3-5(6)4-2;4-1-3(6)2-5/h3-4H2,1-2H3;3-6H,1-2H2.
What are the key properties of pentan-3-one;propane-1,2,3-triol?
pentan-3-one;propane-1,2,3-triol has a molecular weight of 178.23 g/mol, XLogP of -0.29, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-one;propane-1,2,3-triol is sourced from PubChem (CID 86639489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).