C27H23F5O7S2 — CID 86639510
1,1,3,3,3-pentafluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxypropane-1-sulfonate;triphenylsulfanium (PubChem CID 86639510) has the molecular formula C27H23F5O7S2 and a molecular weight of 618.60 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxypropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxypropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86639510 |
| Molecular Formula | C27H23F5O7S2 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxypropane-1-sulfonate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H9F5O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)6(16)20-3-5(15)21-7(8(10,11)12)9(13,14)22(17,18)19/h1-15H;7H,1,3H2,2H3,(H,17,18,19)/q+1;/p-1 |
| InChIKey | UQMVWUUZRKJMOD-UHFFFAOYSA-M |
| XLogP | 5.50 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|