C29H27F5O7S2 — CID 86639511
1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propane-1-sulfonate;triphenylsulfanium (PubChem CID 86639511) has the molecular formula C29H27F5O7S2 and a molecular weight of 646.65 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86639511 |
| Molecular Formula | C29H27F5O7S2 |
| Molecular Weight | 646.65 g/mol |
| Exact Mass | 646.11 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]propane-1-sulfonate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OCCCC(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C11H13F5O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6(2)8(18)22-5-3-4-7(17)23-9(10(12,13)14)11(15,16)24(19,20)21/h1-15H;9H,1,3-5H2,2H3,(H,19,20,21)/q+1;/p-1 |
| InChIKey | MXLCXTIOKUGCPS-UHFFFAOYSA-M |
| XLogP | 6.28 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|