About (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene
(2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene (PubChem CID 86640149) has the molecular formula C15H15N3O6S3
and a molecular weight of 429.50 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene.
Molecular Properties
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene |
| PubChem CID | 86640149 |
| Molecular Formula | C15H15N3O6S3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene |
| SMILES | N[C@@H](CS)C(=O)O.O=[N+]([O-])c1ccc(SSc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C12H8N2O4S2.C3H7NO2S/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18;4-2(1-7)3(5)6/h1-8H;2,7H,1,4H2,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | XOBJTVVLJNAOHL-WNQIDUERSA-N |
| XLogP | 3.63 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene?
The IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene (CID 86640149) is (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene.
What is the SMILES notation for (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene?
The canonical SMILES for (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene is N[C@@H](CS)C(=O)O.O=[N+]([O-])c1ccc(SSc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene?
The InChIKey is XOBJTVVLJNAOHL-WNQIDUERSA-N. The full InChI is InChI=1S/C12H8N2O4S2.C3H7NO2S/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18;4-2(1-7)3(5)6/h1-8H;2,7H,1,4H2,(H,5,6)/t;2-/m.0/s1.
What are the key properties of (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene?
(2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene has a molecular weight of 429.50 g/mol, XLogP of 3.63, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-sulfanylpropanoic acid;1-nitro-4-[(4-nitrophenyl)disulfanyl]benzene is sourced from PubChem (CID 86640149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).