C24H18F9N3O6S — CID 86640730
[(4R)-2-amino-3'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 86640730) has the molecular formula C24H18F9N3O6S and a molecular weight of 647.47 g/mol. Its IUPAC name is [(4R)-2-amino-3'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(4R)-2-amino-3'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 86640730 |
| Molecular Formula | C24H18F9N3O6S |
| Molecular Weight | 647.47 g/mol |
| Exact Mass | 647.08 |
| IUPAC Name | [(4R)-2-amino-3'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COC(C)(C)C#Cc1cnc2c(c1)[C@@]1(COC(N)=N1)c1cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1O2 |
| InChI | InChI=1S/C24H18F9N3O6S/c1-19(2,39-3)7-6-12-8-15-17(35-10-12)41-16-5-4-13(9-14(16)20(15)11-40-18(34)36-20)42-43(37,38)24(32,33)22(27,28)21(25,26)23(29,30)31/h4-5,8-10H,11H2,1-3H3,(H2,34,36)/t20-/m1/s1 |
| InChIKey | FVXXKAQQOZZNCZ-HXUWFJFHSA-N |
| XLogP | 4.69 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|