C23H16F9N3O6S — CID 86640731
[(4S)-2-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 86640731) has the molecular formula C23H16F9N3O6S and a molecular weight of 633.45 g/mol. Its IUPAC name is [(4S)-2-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(4S)-2-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 86640731 |
| Molecular Formula | C23H16F9N3O6S |
| Molecular Weight | 633.45 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | [(4S)-2-amino-3'-(3-hydroxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(O)C#Cc1cnc2c(c1)[C@]1(COC(N)=N1)c1cc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1O2 |
| InChI | InChI=1S/C23H16F9N3O6S/c1-18(2,36)6-5-11-7-14-16(34-9-11)40-15-4-3-12(8-13(15)19(14)10-39-17(33)35-19)41-42(37,38)23(31,32)21(26,27)20(24,25)22(28,29)30/h3-4,7-9,36H,10H2,1-2H3,(H2,33,35)/t19-/m0/s1 |
| InChIKey | XJSWPRWFANSQSU-IBGZPJMESA-N |
| XLogP | 4.03 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|