C20H19F3N2O6S — CID 86640867
methyl 3-[4-methoxy-5-(1-methylindazol-5-yl)-2-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 86640867) has the molecular formula C20H19F3N2O6S and a molecular weight of 472.44 g/mol. Its IUPAC name is methyl 3-[4-methoxy-5-(1-methylindazol-5-yl)-2-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | methyl 3-[4-methoxy-5-(1-methylindazol-5-yl)-2-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 86640867 |
| Molecular Formula | C20H19F3N2O6S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | methyl 3-[4-methoxy-5-(1-methylindazol-5-yl)-2-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(-c2ccc3c(cnn3C)c2)c(OC)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N2O6S/c1-25-16-6-4-12(8-14(16)11-24-25)15-9-13(5-7-19(26)30-3)17(10-18(15)29-2)31-32(27,28)20(21,22)23/h4,6,8-11H,5,7H2,1-3H3 |
| InChIKey | NRZZUUPRNPNQPO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|