C8H6F11NO3 — CID 86641009
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-hydroxyethyl)propanamide (PubChem CID 86641009) has the molecular formula C8H6F11NO3 and a molecular weight of 373.12 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-hydroxyethyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 86641009 |
| Molecular Formula | C8H6F11NO3 |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-hydroxyethyl)propanamide |
| SMILES | O=C(NCCO)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F11NO3/c9-4(6(12,13)14,3(22)20-1-2-21)23-8(18,19)5(10,11)7(15,16)17/h21H,1-2H2,(H,20,22) |
| InChIKey | OMNDMPVDPPWECC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|