C15H11Cl2FN2O3 — CID 8664111
[(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-fluorobenzoate (PubChem CID 8664111) has the molecular formula C15H11Cl2FN2O3 and a molecular weight of 357.17 g/mol. Its IUPAC name is [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-fluorobenzoate.
| Compound Name | [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8664111 |
| Molecular Formula | C15H11Cl2FN2O3 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | [(2S)-1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-chloro-2-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(Cl)cc1F)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H11Cl2FN2O3/c1-8(14(21)20-13-5-3-10(17)7-19-13)23-15(22)11-4-2-9(16)6-12(11)18/h2-8H,1H3,(H,19,20,21)/t8-/m0/s1 |
| InChIKey | MQDZRRDPZPMOTF-QMMMGPOBSA-N |
| XLogP | 3.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |