About ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate
ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate (PubChem CID 86641145) has the molecular formula C19H16F2N2O4
and a molecular weight of 374.34 g/mol. Its IUPAC name is ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate |
| PubChem CID | 86641145 |
| Molecular Formula | C19H16F2N2O4 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2c(F)c(OC)cc(OC)c2F)c2nccnc12 |
| InChI | InChI=1S/C19H16F2N2O4/c1-4-27-19(24)11-6-5-10(17-18(11)23-8-7-22-17)14-15(20)12(25-2)9-13(26-3)16(14)21/h5-9H,4H2,1-3H3 |
| InChIKey | CFQBCIVTEKWLGC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate?
The IUPAC name of ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate (CID 86641145) is ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate.
What is the SMILES notation for ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate?
The canonical SMILES for ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate is CCOC(=O)c1ccc(-c2c(F)c(OC)cc(OC)c2F)c2nccnc12.
What is the InChIKey of ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate?
The InChIKey is CFQBCIVTEKWLGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2O4/c1-4-27-19(24)11-6-5-10(17-18(11)23-8-7-22-17)14-15(20)12(25-2)9-13(26-3)16(14)21/h5-9H,4H2,1-3H3.
What are the key properties of ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate?
ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate has a molecular weight of 374.34 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-(2,6-difluoro-3,5-dimethoxyphenyl)quinoxaline-5-carboxylate is sourced from PubChem (CID 86641145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).