C12H21N4O5P — CID 86641300
N-[(1R,2R,6S)-6-azido-4-diethoxyphosphoryl-2-hydroxycyclohex-3-en-1-yl]acetamide (PubChem CID 86641300) has the molecular formula C12H21N4O5P and a molecular weight of 332.30 g/mol. Its IUPAC name is N-[(1R,2R,6S)-6-azido-4-diethoxyphosphoryl-2-hydroxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-6-azido-4-diethoxyphosphoryl-2-hydroxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 86641300 |
| Molecular Formula | C12H21N4O5P |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(1R,2R,6S)-6-azido-4-diethoxyphosphoryl-2-hydroxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCOP(=O)(OCC)C1=C[C@@H](O)[C@H](NC(C)=O)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C12H21N4O5P/c1-4-20-22(19,21-5-2)9-6-10(15-16-13)12(11(18)7-9)14-8(3)17/h7,10-12,18H,4-6H2,1-3H3,(H,14,17)/t10-,11+,12+/m0/s1 |
| InChIKey | DONQZWVLWJGRIQ-QJPTWQEYSA-N |
| XLogP | 2.08 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|