About tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate
tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate (PubChem CID 86641480) has the molecular formula C13H14ClN3O4
and a molecular weight of 311.73 g/mol. Its IUPAC name is tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate |
| PubChem CID | 86641480 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(=O)[nH]c2ccnc(Cl)c2c1=O |
| InChI | InChI=1S/C13H14ClN3O4/c1-13(2,3)21-8(18)6-17-11(19)9-7(16-12(17)20)4-5-15-10(9)14/h4-5H,6H2,1-3H3,(H,16,20) |
| InChIKey | IGLPHZCYGQYGIQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate?
The IUPAC name of tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate (CID 86641480) is tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate.
What is the SMILES notation for tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate?
The canonical SMILES for tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate is CC(C)(C)OC(=O)Cn1c(=O)[nH]c2ccnc(Cl)c2c1=O.
What is the InChIKey of tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate?
The InChIKey is IGLPHZCYGQYGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN3O4/c1-13(2,3)21-8(18)6-17-11(19)9-7(16-12(17)20)4-5-15-10(9)14/h4-5H,6H2,1-3H3,(H,16,20).
What are the key properties of tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate?
tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate has a molecular weight of 311.73 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(5-chloro-2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate is sourced from PubChem (CID 86641480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).