C23H30F3N3O5S — CID 86641490
(4-methylpiperidin-1-yl)-(5-propylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 86641490) has the molecular formula C23H30F3N3O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-(5-propylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-methylpiperidin-1-yl)-(5-propylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86641490 |
| Molecular Formula | C23H30F3N3O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | (4-methylpiperidin-1-yl)-(5-propylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CCCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29N3O3S.C2HF3O2/c1-3-12-28(26,27)24-19-5-4-16(21(25)23-10-7-15(2)8-11-23)13-17(19)18-14-22-9-6-20(18)24;3-2(4,5)1(6)7/h4-5,13,15,22H,3,6-12,14H2,1-2H3;(H,6,7) |
| InChIKey | RUXCJXLJFGJTRH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |