C22H28F3N3O5S — CID 86641492
(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 86641492) has the molecular formula C22H28F3N3O5S and a molecular weight of 503.54 g/mol. Its IUPAC name is (5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86641492 |
| Molecular Formula | C22H28F3N3O5S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl)-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O3S.C2HF3O2/c1-3-27(25,26)23-18-5-4-15(20(24)22-10-7-14(2)8-11-22)12-16(18)17-13-21-9-6-19(17)23;3-2(4,5)1(6)7/h4-5,12,14,21H,3,6-11,13H2,1-2H3;(H,6,7) |
| InChIKey | LADKLGINDFXOSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |