C26H28F3N3O5S — CID 86641497
[5-(benzenesulfonyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 86641497) has the molecular formula C26H28F3N3O5S and a molecular weight of 551.59 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [5-(benzenesulfonyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86641497 |
| Molecular Formula | C26H28F3N3O5S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [5-(benzenesulfonyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]-(4-methylpiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCN(C(=O)c2ccc3c(c2)c2c(n3S(=O)(=O)c3ccccc3)CCNC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H27N3O3S.C2HF3O2/c1-17-10-13-26(14-11-17)24(28)18-7-8-22-20(15-18)21-16-25-12-9-23(21)27(22)31(29,30)19-5-3-2-4-6-19;3-2(4,5)1(6)7/h2-8,15,17,25H,9-14,16H2,1H3;(H,6,7) |
| InChIKey | LILYPEYBNDQRHH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |