C18H14ClNO4 — CID 86641624
8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol chloride (PubChem CID 86641624) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is 8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol chloride.
| Compound Name | 8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol chloride |
|---|---|
| PubChem CID | 86641624 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 8-methyl-1,6-dihydroisoquinolino[2,1-b]isoquinolin-1-ylium-2,3,10,11-tetrol chloride |
| SMILES | CC1=c2cc(O)c(O)cc2=CC2=C3[C+]=C(O)C(O)=CC3=CCN21.[Cl-] |
| InChI | InChI=1S/C18H13NO4.ClH/c1-9-12-7-17(22)16(21)6-11(12)4-14-13-8-18(23)15(20)5-10(13)2-3-19(9)14;/h2,4-7H,3H2,1H3,(H3-,20,21,22,23);1H |
| InChIKey | LLJNAUFQJIGUBT-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|