C23H24N4O4 — CID 86641868
7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepine-4-carboxylic acid (PubChem CID 86641868) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepine-4-carboxylic acid.
| Compound Name | 7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 86641868 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 7-[(E)-3-[methyl-[(3-methyl-1-benzofuran-2-yl)methyl]amino]-3-oxoprop-1-enyl]-1,2,3,5-tetrahydropyrido[2,3-e][1,4]diazepine-4-carboxylic acid |
| SMILES | Cc1c(CN(C)C(=O)/C=C/c2cnc3c(c2)CN(C(=O)O)CCN3)oc2ccccc12 |
| InChI | InChI=1S/C23H24N4O4/c1-15-18-5-3-4-6-19(18)31-20(15)14-26(2)21(28)8-7-16-11-17-13-27(23(29)30)10-9-24-22(17)25-12-16/h3-8,11-12H,9-10,13-14H2,1-2H3,(H,24,25)(H,29,30)/b8-7+ |
| InChIKey | DIZRWEFFMUFICJ-BQYQJAHWSA-N |
| XLogP | 3.71 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|