C15H9BrCl2F3NO2 — CID 86642185
1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-1-one (PubChem CID 86642185) has the molecular formula C15H9BrCl2F3NO2 and a molecular weight of 443.05 g/mol. Its IUPAC name is 1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-1-one.
| Compound Name | 1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-1-one |
|---|---|
| PubChem CID | 86642185 |
| Molecular Formula | C15H9BrCl2F3NO2 |
| Molecular Weight | 443.05 g/mol |
| Exact Mass | 440.91 |
| IUPAC Name | 1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-1-one |
| SMILES | O=C(CC(O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C15H9BrCl2F3NO2/c16-13-2-1-8(7-22-13)12(23)6-14(24,15(19,20)21)9-3-10(17)5-11(18)4-9/h1-5,7,24H,6H2 |
| InChIKey | SKDMSGHNOUADCD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.05 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|