About tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate
tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate (PubChem CID 86642657) has the molecular formula C20H26F2N4O3
and a molecular weight of 408.45 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate |
| PubChem CID | 86642657 |
| Molecular Formula | C20H26F2N4O3 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCn2c(=O)cnc3c(F)cc(F)cc32)CC1 |
| InChI | InChI=1S/C20H26F2N4O3/c1-20(2,3)29-19(28)24-14-4-6-25(7-5-14)8-9-26-16-11-13(21)10-15(22)18(16)23-12-17(26)27/h10-12,14H,4-9H2,1-3H3,(H,24,28) |
| InChIKey | VQZOYOCJMUWGMX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate?
The IUPAC name of tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate (CID 86642657) is tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate is CC(C)(C)OC(=O)NC1CCN(CCn2c(=O)cnc3c(F)cc(F)cc32)CC1.
What is the InChIKey of tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate?
The InChIKey is VQZOYOCJMUWGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F2N4O3/c1-20(2,3)29-19(28)24-14-4-6-25(7-5-14)8-9-26-16-11-13(21)10-15(22)18(16)23-12-17(26)27/h10-12,14H,4-9H2,1-3H3,(H,24,28).
What are the key properties of tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate?
tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate has a molecular weight of 408.45 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[2-(5,7-difluoro-2-oxoquinoxalin-1-yl)ethyl]piperidin-4-yl]carbamate is sourced from PubChem (CID 86642657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).