C12H16F8O4S — CID 86642975
methyl 6,6,7,7,7-pentafluoro-5-methyl-2-(3,3,3-trifluoropropylsulfonyl)heptanoate (PubChem CID 86642975) has the molecular formula C12H16F8O4S and a molecular weight of 408.31 g/mol. Its IUPAC name is methyl 6,6,7,7,7-pentafluoro-5-methyl-2-(3,3,3-trifluoropropylsulfonyl)heptanoate.
| Compound Name | methyl 6,6,7,7,7-pentafluoro-5-methyl-2-(3,3,3-trifluoropropylsulfonyl)heptanoate |
|---|---|
| PubChem CID | 86642975 |
| Molecular Formula | C12H16F8O4S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | methyl 6,6,7,7,7-pentafluoro-5-methyl-2-(3,3,3-trifluoropropylsulfonyl)heptanoate |
| SMILES | COC(=O)C(CCC(C)C(F)(F)C(F)(F)F)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H16F8O4S/c1-7(11(16,17)12(18,19)20)3-4-8(9(21)24-2)25(22,23)6-5-10(13,14)15/h7-8H,3-6H2,1-2H3 |
| InChIKey | OTFXLGUWWGGCPY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|