C30H29FN6O4 — CID 86643035
3-[6-fluoro-3-(2-hydroxyethyl)-2-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-9-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione (PubChem CID 86643035) has the molecular formula C30H29FN6O4 and a molecular weight of 556.60 g/mol. Its IUPAC name is 3-[6-fluoro-3-(2-hydroxyethyl)-2-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-9-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione.
| Compound Name | 3-[6-fluoro-3-(2-hydroxyethyl)-2-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-9-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 86643035 |
| Molecular Formula | C30H29FN6O4 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 3-[6-fluoro-3-(2-hydroxyethyl)-2-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-9-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cnc3ccccn23)=C1C1=NCCN2c3c1cc(F)cc3C(CCO)C2C(=O)N1CCCCC1 |
| InChI | InChI=1S/C30H29FN6O4/c31-17-14-19-18(7-13-38)27(30(41)35-9-3-1-4-10-35)37-12-8-32-25(20(15-17)26(19)37)24-23(28(39)34-29(24)40)21-16-33-22-6-2-5-11-36(21)22/h2,5-6,11,14-16,18,27,38H,1,3-4,7-10,12-13H2,(H,34,39,40) |
| InChIKey | GBOCWIVUBWEAMG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|