C16H16F3NO5S — CID 86643218
4-methylbenzenesulfonic acid;N-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydroxylamine (PubChem CID 86643218) has the molecular formula C16H16F3NO5S and a molecular weight of 391.37 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;N-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydroxylamine.
| Compound Name | 4-methylbenzenesulfonic acid;N-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 86643218 |
| Molecular Formula | C16H16F3NO5S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-methylbenzenesulfonic acid;N-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]hydroxylamine |
| SMILES | COc1cccc(C(=NO)C(F)(F)F)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H8F3NO2.C7H8O3S/c1-15-7-4-2-3-6(5-7)8(13-14)9(10,11)12;1-6-2-4-7(5-3-6)11(8,9)10/h2-5,14H,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | WXUOOOYKKSNOSS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|