About tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate
tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate (PubChem CID 86643354) has the molecular formula C14H14BrF6NO2
and a molecular weight of 422.16 g/mol. Its IUPAC name is tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate |
| PubChem CID | 86643354 |
| Molecular Formula | C14H14BrF6NO2 |
| Molecular Weight | 422.16 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate |
| SMILES | CC(C)(C)OC(=O)CNc1cc(C(F)(F)F)c(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14BrF6NO2/c1-12(2,3)24-10(23)6-22-7-4-8(13(16,17)18)11(15)9(5-7)14(19,20)21/h4-5,22H,6H2,1-3H3 |
| InChIKey | XBGKRLHBRDHMGB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.16 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate?
The IUPAC name of tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate (CID 86643354) is tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate.
What is the SMILES notation for tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate?
The canonical SMILES for tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate is CC(C)(C)OC(=O)CNc1cc(C(F)(F)F)c(Br)c(C(F)(F)F)c1.
What is the InChIKey of tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate?
The InChIKey is XBGKRLHBRDHMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrF6NO2/c1-12(2,3)24-10(23)6-22-7-4-8(13(16,17)18)11(15)9(5-7)14(19,20)21/h4-5,22H,6H2,1-3H3.
What are the key properties of tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate?
tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate has a molecular weight of 422.16 g/mol, XLogP of 5.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-bromo-3,5-bis(trifluoromethyl)anilino]acetate is sourced from PubChem (CID 86643354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).