About 4-propan-2-ylbenzene-1,3-dicarbaldehyde
4-propan-2-ylbenzene-1,3-dicarbaldehyde (PubChem CID 86643444) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-propan-2-ylbenzene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 4-propan-2-ylbenzene-1,3-dicarbaldehyde |
| PubChem CID | 86643444 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-propan-2-ylbenzene-1,3-dicarbaldehyde |
| SMILES | CC(C)c1ccc(C=O)cc1C=O |
| InChI | InChI=1S/C11H12O2/c1-8(2)11-4-3-9(6-12)5-10(11)7-13/h3-8H,1-2H3 |
| InChIKey | JQDZDAOUBYJRRZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylbenzene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylbenzene-1,3-dicarbaldehyde?
The IUPAC name of 4-propan-2-ylbenzene-1,3-dicarbaldehyde (CID 86643444) is 4-propan-2-ylbenzene-1,3-dicarbaldehyde.
What is the SMILES notation for 4-propan-2-ylbenzene-1,3-dicarbaldehyde?
The canonical SMILES for 4-propan-2-ylbenzene-1,3-dicarbaldehyde is CC(C)c1ccc(C=O)cc1C=O.
What is the InChIKey of 4-propan-2-ylbenzene-1,3-dicarbaldehyde?
The InChIKey is JQDZDAOUBYJRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-8(2)11-4-3-9(6-12)5-10(11)7-13/h3-8H,1-2H3.
What are the key properties of 4-propan-2-ylbenzene-1,3-dicarbaldehyde?
4-propan-2-ylbenzene-1,3-dicarbaldehyde has a molecular weight of 176.22 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylbenzene-1,3-dicarbaldehyde is sourced from PubChem (CID 86643444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).