About ethane-1,1-diol;hydrate
ethane-1,1-diol;hydrate (PubChem CID 86643495) has the molecular formula C2H8O3
and a molecular weight of 80.08 g/mol. Its IUPAC name is ethane-1,1-diol;hydrate.
Molecular Properties
| Compound Name | ethane-1,1-diol;hydrate |
| PubChem CID | 86643495 |
| Molecular Formula | C2H8O3 |
| Molecular Weight | 80.08 g/mol |
| Exact Mass | 80.05 |
| IUPAC Name | ethane-1,1-diol;hydrate |
| SMILES | CC(O)O.O |
| InChI | InChI=1S/C2H6O2.H2O/c1-2(3)4;/h2-4H,1H3;1H2 |
| InChIKey | XCBJLAUUUJAELM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.08 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1-diol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1-diol;hydrate?
The IUPAC name of ethane-1,1-diol;hydrate (CID 86643495) is ethane-1,1-diol;hydrate.
What is the SMILES notation for ethane-1,1-diol;hydrate?
The canonical SMILES for ethane-1,1-diol;hydrate is CC(O)O.O.
What is the InChIKey of ethane-1,1-diol;hydrate?
The InChIKey is XCBJLAUUUJAELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O2.H2O/c1-2(3)4;/h2-4H,1H3;1H2.
What are the key properties of ethane-1,1-diol;hydrate?
ethane-1,1-diol;hydrate has a molecular weight of 80.08 g/mol, XLogP of -1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1-diol;hydrate is sourced from PubChem (CID 86643495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).